[(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid

Quality products?make an important contribution to long-term revenue and profitability. Factory supply [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid 93962-55-1 with sufficient production capacity

1.What is the [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid ?

[(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid is a chemical compound characterized by the molecular formula C10H11ClO4S. It is a thioether derivative of acetic acid, featuring a chloro and two methoxy groups on the phenyl ring. [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid exhibits potential biological activity and has been investigated for its pharmacological properties. Its unique structure and possible therapeutic effects also make it a compound of interest in the fields of medicinal chemistry and drug discovery.

2.What is the CAS number for [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid ?

The CAS number of [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid is 93962-55-1.

3.What are another words for [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid ?

Synonyms?for?[(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid 93962-55-1:Aceticacid, [(4-chloro-2,5-dimethoxyphenyl)thio]- (9CI)

4.What is [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid (93962-55-1) used for?

Used in Pharmaceutical Applications:
[(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid is used as a building block for the synthesis of other organic compounds, particularly in the pharmaceutical industry. Its unique structure and potential therapeutic effects contribute to the development of new drugs and therapeutic agents.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid is utilized as a key component in the design and synthesis of novel molecules with potential therapeutic applications. Its chemical and biological properties make it a valuable compound for research and development.
Used in Drug Discovery:
[(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid's potential biological activity and pharmacological properties make it a promising candidate for drug discovery. Researchers can use [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid to explore new avenues in the development of treatments for various diseases and conditions.
Overall, [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid is a versatile compound with applications in various scientific fields, including pharmaceuticals, medicinal chemistry, and drug discovery, due to its unique structure and potential therapeutic effects.

InChI:InChI=1/C10H11ClO4S/c1-14-7-4-9(16-5-10(12)13)8(15-2)3-6(7)11/h3-4H,5H2,1-2H3,(H,12,13)

Relevant articles related to [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid:

5.Buy [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid with the best price .

Antaeus Bio-technology Co., LTD is a quality supplier of [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on [(4-chloro-2,5-dimethoxyphenyl)thio]acetic acid 93962-55-1.